C17H19N3O — CID 4650351
3-methyl-N-(4-phenyldiazenylphenyl)butanamide (PubChem CID 4650351) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-methyl-N-(4-phenyldiazenylphenyl)butanamide.
| Compound Name | 3-methyl-N-(4-phenyldiazenylphenyl)butanamide |
|---|---|
| PubChem CID | 4650351 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-methyl-N-(4-phenyldiazenylphenyl)butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-13(2)12-17(21)18-14-8-10-16(11-9-14)20-19-15-6-4-3-5-7-15/h3-11,13H,12H2,1-2H3,(H,18,21)/b20-19+ |
| InChIKey | WUKKVSGAXJMUQQ-FMQUCBEESA-N |
| XLogP | 5.09 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|