C21H27N5O2 — CID 8907332
2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 8907332) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 8907332 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(/N=N/c2ccccc2)cc1)CC(=O)NC(C)C |
| InChI | InChI=1S/C21H27N5O2/c1-4-26(14-20(27)22-16(2)3)15-21(28)23-17-10-12-19(13-11-17)25-24-18-8-6-5-7-9-18/h5-13,16H,4,14-15H2,1-3H3,(H,22,27)(H,23,28)/b25-24+ |
| InChIKey | POPPUFLQXWXWAF-OCOZRVBESA-N |
| XLogP | 3.89 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|