C12H17N3OS — CID 60729665
2-[(2-amino-2-sulfanylideneethyl)-ethylamino]-N-phenylacetamide (PubChem CID 60729665) has the molecular formula C12H17N3OS and a molecular weight of 251.36 g/mol. Its IUPAC name is 2-[(2-amino-2-sulfanylideneethyl)-ethylamino]-N-phenylacetamide.
| Compound Name | 2-[(2-amino-2-sulfanylideneethyl)-ethylamino]-N-phenylacetamide |
|---|---|
| PubChem CID | 60729665 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-[(2-amino-2-sulfanylideneethyl)-ethylamino]-N-phenylacetamide |
| SMILES | CCN(CC(=O)Nc1ccccc1)CC(N)=S |
| InChI | InChI=1S/C12H17N3OS/c1-2-15(8-11(13)17)9-12(16)14-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H2,13,17)(H,14,16) |
| InChIKey | GDPUQGRKNLLXCB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|