C12H18N2O — CID 15707008
N-(2-deuteriophenyl)-2-(diethylamino)acetamide (PubChem CID 15707008) has the molecular formula C12H18N2O and a molecular weight of 207.30 g/mol. Its IUPAC name is N-(2-deuteriophenyl)-2-(diethylamino)acetamide.
| Compound Name | N-(2-deuteriophenyl)-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 15707008 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | N-(2-deuteriophenyl)-2-(diethylamino)acetamide |
| SMILES | [2H]c1ccccc1NC(=O)CN(CC)CC |
| InChI | InChI=1S/C12H18N2O/c1-3-14(4-2)10-12(15)13-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,13,15)/i8D |
| InChIKey | BZOYWRSQDKFTPI-BNEYPBHNSA-N |
| XLogP | 1.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |