C15H24N4O4S — CID 39895252
2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 39895252) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 39895252 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(S(N)(=O)=O)c1)CC(=O)NC(C)C |
| InChI | InChI=1S/C15H24N4O4S/c1-4-19(9-14(20)17-11(2)3)10-15(21)18-12-6-5-7-13(8-12)24(16,22)23/h5-8,11H,4,9-10H2,1-3H3,(H,17,20)(H,18,21)(H2,16,22,23) |
| InChIKey | XILYWNHKKIHSNQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |