C20H27N3O4S — CID 95786408
2-[ethyl-[(2S)-1-methoxy-3-phenylpropan-2-yl]amino]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 95786408) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[ethyl-[(2S)-1-methoxy-3-phenylpropan-2-yl]amino]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[ethyl-[(2S)-1-methoxy-3-phenylpropan-2-yl]amino]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 95786408 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[ethyl-[(2S)-1-methoxy-3-phenylpropan-2-yl]amino]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(S(N)(=O)=O)c1)[C@H](COC)Cc1ccccc1 |
| InChI | InChI=1S/C20H27N3O4S/c1-3-23(18(15-27-2)12-16-8-5-4-6-9-16)14-20(24)22-17-10-7-11-19(13-17)28(21,25)26/h4-11,13,18H,3,12,14-15H2,1-2H3,(H,22,24)(H2,21,25,26)/t18-/m0/s1 |
| InChIKey | RPLOMVUEPMJUJP-SFHVURJKSA-N |
| XLogP | 1.85 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |