C28H32N4O3 — CID 54839278
3-methyl-N-[4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]butanamide (PubChem CID 54839278) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54839278 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 3-methyl-N-[4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)CNc2ccc(NC(=O)CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O3/c1-20(2)18-27(34)31-24-13-15-25(16-14-24)32-28(35)19-29-22-9-11-23(12-10-22)30-26(33)17-8-21-6-4-3-5-7-21/h3-7,9-16,20,29H,8,17-19H2,1-2H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | FSOJNEJFEPNVRG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |