C28H32N4O3 — CID 54834109
N,N-diethyl-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide (PubChem CID 54834109) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834109 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N,N-diethyl-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NCC(=O)Nc2ccc(NC(=O)CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O3/c1-3-32(4-2)28(35)22-11-13-23(14-12-22)29-20-27(34)31-25-17-15-24(16-18-25)30-26(33)19-10-21-8-6-5-7-9-21/h5-9,11-18,29H,3-4,10,19-20H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | RBHRALSYBPBVQU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |