C19H22IN3O2 — CID 54812461
N,N-diethyl-4-[[2-(4-iodoanilino)acetyl]amino]benzamide (PubChem CID 54812461) has the molecular formula C19H22IN3O2 and a molecular weight of 451.31 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(4-iodoanilino)acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-(4-iodoanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54812461 |
| Molecular Formula | C19H22IN3O2 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N,N-diethyl-4-[[2-(4-iodoanilino)acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CNc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C19H22IN3O2/c1-3-23(4-2)19(25)14-5-9-17(10-6-14)22-18(24)13-21-16-11-7-15(20)8-12-16/h5-12,21H,3-4,13H2,1-2H3,(H,22,24) |
| InChIKey | IBOUJZFWBKEGGZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|