C21H26IN3O2 — CID 54832241
4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide (PubChem CID 54832241) has the molecular formula C21H26IN3O2 and a molecular weight of 479.36 g/mol. Its IUPAC name is 4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54832241 |
| Molecular Formula | C21H26IN3O2 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NCC(=O)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C21H26IN3O2/c1-3-13-25(14-4-2)21(27)16-5-9-18(10-6-16)23-15-20(26)24-19-11-7-17(22)8-12-19/h5-12,23H,3-4,13-15H2,1-2H3,(H,24,26) |
| InChIKey | MQBPFDGVBOMZEG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|