C28H33N3O3 — CID 54832179
4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]-N,N-dipropylbenzamide (PubChem CID 54832179) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54832179 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NCC(=O)Nc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H33N3O3/c1-3-18-31(19-4-2)28(33)23-10-12-24(13-11-23)29-20-27(32)30-25-14-16-26(17-15-25)34-21-22-8-6-5-7-9-22/h5-17,29H,3-4,18-21H2,1-2H3,(H,30,32) |
| InChIKey | KTMNFXCTHZIIRT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |