C27H39N3O3 — CID 54820826
4-[[2-(4-hexoxyanilino)acetyl]amino]-N,N-dipropylbenzamide (PubChem CID 54820826) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is 4-[[2-(4-hexoxyanilino)acetyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[2-(4-hexoxyanilino)acetyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54820826 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | 4-[[2-(4-hexoxyanilino)acetyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCCCCOc1ccc(NCC(=O)Nc2ccc(C(=O)N(CCC)CCC)cc2)cc1 |
| InChI | InChI=1S/C27H39N3O3/c1-4-7-8-9-20-33-25-16-14-23(15-17-25)28-21-26(31)29-24-12-10-22(11-13-24)27(32)30(18-5-2)19-6-3/h10-17,28H,4-9,18-21H2,1-3H3,(H,29,31) |
| InChIKey | YDQZXVMGJKGRAA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|