C24H33N3O3 — CID 54820861
4-[[2-(4-hexoxyanilino)acetyl]amino]-N-propan-2-ylbenzamide (PubChem CID 54820861) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[[2-(4-hexoxyanilino)acetyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 4-[[2-(4-hexoxyanilino)acetyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 54820861 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 4-[[2-(4-hexoxyanilino)acetyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CCCCCCOc1ccc(NCC(=O)Nc2ccc(C(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O3/c1-4-5-6-7-16-30-22-14-12-20(13-15-22)25-17-23(28)27-21-10-8-19(9-11-21)24(29)26-18(2)3/h8-15,18,25H,4-7,16-17H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | LGTJEEMGXFWJBP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|