C22H29N3O3 — CID 54834104
N,N-diethyl-4-[[2-oxo-2-(4-propoxyanilino)ethyl]amino]benzamide (PubChem CID 54834104) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-oxo-2-(4-propoxyanilino)ethyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-oxo-2-(4-propoxyanilino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834104 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N,N-diethyl-4-[[2-oxo-2-(4-propoxyanilino)ethyl]amino]benzamide |
| SMILES | CCCOc1ccc(NC(=O)CNc2ccc(C(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-4-15-28-20-13-11-19(12-14-20)24-21(26)16-23-18-9-7-17(8-10-18)22(27)25(5-2)6-3/h7-14,23H,4-6,15-16H2,1-3H3,(H,24,26) |
| InChIKey | SKJPUORUIIDADK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |