C19H22BrN3O2 — CID 54834198
4-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-diethylbenzamide (PubChem CID 54834198) has the molecular formula C19H22BrN3O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is 4-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 54834198 |
| Molecular Formula | C19H22BrN3O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 4-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NCC(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H22BrN3O2/c1-3-23(4-2)19(25)14-5-9-16(10-6-14)21-13-18(24)22-17-11-7-15(20)8-12-17/h5-12,21H,3-4,13H2,1-2H3,(H,22,24) |
| InChIKey | QHVPIRFDNBPOFI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |