C22H28ClN3O2 — CID 54832242
4-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide (PubChem CID 54832242) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 4-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54832242 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-[[2-(3-chloro-4-methylanilino)-2-oxoethyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NCC(=O)Nc2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-4-12-26(13-5-2)22(28)17-7-10-18(11-8-17)24-15-21(27)25-19-9-6-16(3)20(23)14-19/h6-11,14,24H,4-5,12-13,15H2,1-3H3,(H,25,27) |
| InChIKey | NFJOFDKAFWKJAH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |