C22H20IN3O2 — CID 54838604
4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide (PubChem CID 54838604) has the molecular formula C22H20IN3O2 and a molecular weight of 485.33 g/mol. Its IUPAC name is 4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide.
| Compound Name | 4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 54838604 |
| Molecular Formula | C22H20IN3O2 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 4-[[2-(4-iodoanilino)-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
| SMILES | CN(C(=O)c1ccc(NCC(=O)Nc2ccc(I)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20IN3O2/c1-26(20-5-3-2-4-6-20)22(28)16-7-11-18(12-8-16)24-15-21(27)25-19-13-9-17(23)10-14-19/h2-14,24H,15H2,1H3,(H,25,27) |
| InChIKey | UDNNSEDZWUMXNS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|