C29H32N4O3 — CID 54838199
4-[[2-[4-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide (PubChem CID 54838199) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-[[2-[4-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide.
| Compound Name | 4-[[2-[4-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 54838199 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 4-[[2-[4-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
| SMILES | CN(C(=O)c1ccc(NCC(=O)Nc2ccc(C(=O)N3CCCCCC3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O3/c1-32(26-9-5-4-6-10-26)28(35)22-11-15-24(16-12-22)30-21-27(34)31-25-17-13-23(14-18-25)29(36)33-19-7-2-3-8-20-33/h4-6,9-18,30H,2-3,7-8,19-21H2,1H3,(H,31,34) |
| InChIKey | COZYFPKWYPKPOL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |