C28H30N4O3 — CID 54843314
N-methyl-N-phenyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide (PubChem CID 54843314) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-methyl-N-phenyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-methyl-N-phenyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54843314 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-methyl-N-phenyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
| SMILES | CN(C(=O)c1ccc(NC(=O)CNc2cccc(C(=O)N3CCCCC3)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N4O3/c1-31(25-11-4-2-5-12-25)27(34)21-13-15-23(16-14-21)30-26(33)20-29-24-10-8-9-22(19-24)28(35)32-17-6-3-7-18-32/h2,4-5,8-16,19,29H,3,6-7,17-18,20H2,1H3,(H,30,33) |
| InChIKey | UXEWMWUUICMDPT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |