C28H30N4O3 — CID 54843316
N-benzyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide (PubChem CID 54843316) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-benzyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-benzyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54843316 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-benzyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
| SMILES | O=C(CNc1cccc(C(=O)N2CCCCC2)c1)Nc1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N4O3/c33-26(20-29-25-11-7-10-23(18-25)28(35)32-16-5-2-6-17-32)31-24-14-12-22(13-15-24)27(34)30-19-21-8-3-1-4-9-21/h1,3-4,7-15,18,29H,2,5-6,16-17,19-20H2,(H,30,34)(H,31,33) |
| InChIKey | JNYBKGRYWGXDRM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |