C25H32N4O3 — CID 54843436
N,N-diethyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide (PubChem CID 54843436) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54843436 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N,N-diethyl-4-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CNc2cccc(C(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-3-28(4-2)24(31)19-11-13-21(14-12-19)27-23(30)18-26-22-10-8-9-20(17-22)25(32)29-15-6-5-7-16-29/h8-14,17,26H,3-7,15-16,18H2,1-2H3,(H,27,30) |
| InChIKey | DOOYOMLQGWCVGD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |