C28H30N4O3 — CID 54841183
N-benzyl-N-methyl-3-[[2-[3-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]benzamide (PubChem CID 54841183) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[[2-[3-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-benzyl-N-methyl-3-[[2-[3-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54841183 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-benzyl-N-methyl-3-[[2-[3-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cccc(NC(=O)CNc2cccc(C(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C28H30N4O3/c1-31(20-21-9-3-2-4-10-21)27(34)22-11-8-14-25(18-22)30-26(33)19-29-24-13-7-12-23(17-24)28(35)32-15-5-6-16-32/h2-4,7-14,17-18,29H,5-6,15-16,19-20H2,1H3,(H,30,33) |
| InChIKey | YGBMVGLMUTWOBD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |