C30H34N4O3 — CID 54830775
N-benzyl-N-methyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]benzamide (PubChem CID 54830775) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-benzyl-N-methyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54830775 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-benzyl-N-methyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]benzamide |
| SMILES | CC1CCN(C(=O)c2ccc(NCC(=O)Nc3cccc(C(=O)N(C)Cc4ccccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C30H34N4O3/c1-22-15-17-34(18-16-22)30(37)24-11-13-26(14-12-24)31-20-28(35)32-27-10-6-9-25(19-27)29(36)33(2)21-23-7-4-3-5-8-23/h3-14,19,22,31H,15-18,20-21H2,1-2H3,(H,32,35) |
| InChIKey | KEJGQMYBQXOLHL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |