C28H30N4O4 — CID 54831877
N-benzyl-N-methyl-3-[[2-[4-(morpholine-4-carbonyl)anilino]acetyl]amino]benzamide (PubChem CID 54831877) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[[2-[4-(morpholine-4-carbonyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-benzyl-N-methyl-3-[[2-[4-(morpholine-4-carbonyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54831877 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-benzyl-N-methyl-3-[[2-[4-(morpholine-4-carbonyl)anilino]acetyl]amino]benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cccc(NC(=O)CNc2ccc(C(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C28H30N4O4/c1-31(20-21-6-3-2-4-7-21)27(34)23-8-5-9-25(18-23)30-26(33)19-29-24-12-10-22(11-13-24)28(35)32-14-16-36-17-15-32/h2-13,18,29H,14-17,19-20H2,1H3,(H,30,33) |
| InChIKey | GZQPXNOQEFTBSZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |