C31H30N4O3 — CID 54838229
4-[[2-[4-[methyl(phenyl)carbamoyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54838229) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 4-[[2-[4-[methyl(phenyl)carbamoyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[[2-[4-[methyl(phenyl)carbamoyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54838229 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 4-[[2-[4-[methyl(phenyl)carbamoyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC(=O)CNc2ccc(C(=O)N(C)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H30N4O3/c1-22(23-9-5-3-6-10-23)33-30(37)24-13-19-27(20-14-24)34-29(36)21-32-26-17-15-25(16-18-26)31(38)35(2)28-11-7-4-8-12-28/h3-20,22,32H,21H2,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | UURMOPOOICUHQQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |