C27H25N3O2 — CID 54839780
4-[[2-(naphthalen-2-ylamino)acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54839780) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[[2-(naphthalen-2-ylamino)acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[[2-(naphthalen-2-ylamino)acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54839780 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-[[2-(naphthalen-2-ylamino)acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC(=O)CNc2ccc3ccccc3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H25N3O2/c1-19(20-7-3-2-4-8-20)29-27(32)22-12-14-24(15-13-22)30-26(31)18-28-25-16-11-21-9-5-6-10-23(21)17-25/h2-17,19,28H,18H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | LRXCHSYMALSVJO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |