C31H31N3O4 — CID 54825206
4-[[2-[3-(2-phenoxyethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54825206) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 4-[[2-[3-(2-phenoxyethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[[2-[3-(2-phenoxyethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54825206 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 4-[[2-[3-(2-phenoxyethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC(=O)CNc2cccc(OCCOc3ccccc3)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H31N3O4/c1-23(24-9-4-2-5-10-24)33-31(36)25-15-17-26(18-16-25)34-30(35)22-32-27-11-8-14-29(21-27)38-20-19-37-28-12-6-3-7-13-28/h2-18,21,23,32H,19-20,22H2,1H3,(H,33,36)(H,34,35) |
| InChIKey | MXOGPZHWPGAVFV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|