C26H28N4O3 — CID 54839192
N-ethyl-4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide (PubChem CID 54839192) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-ethyl-4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide.
| Compound Name | N-ethyl-4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54839192 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-ethyl-4-[[2-[4-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)CNc2ccc(NC(=O)CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H28N4O3/c1-2-27-26(33)20-9-11-22(12-10-20)30-25(32)18-28-21-13-15-23(16-14-21)29-24(31)17-8-19-6-4-3-5-7-19/h3-7,9-16,28H,2,8,17-18H2,1H3,(H,27,33)(H,29,31)(H,30,32) |
| InChIKey | TYXUMEQYTZYWQY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |