C29H28N4O4 — CID 54842956
N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide (PubChem CID 54842956) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54842956 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(NC(=O)CNc2ccc(C(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C29H28N4O4/c34-27(17-8-21-5-2-1-3-6-21)32-24-13-15-25(16-14-24)33-28(35)20-30-23-11-9-22(10-12-23)29(36)31-19-26-7-4-18-37-26/h1-7,9-16,18,30H,8,17,19-20H2,(H,31,36)(H,32,34)(H,33,35) |
| InChIKey | NUPSDXUENHQKHU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |