C23H25N3O5 — CID 54822273
N-(furan-2-ylmethyl)-4-[[2-[4-(2-methoxyethoxy)anilino]acetyl]amino]benzamide (PubChem CID 54822273) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[[2-[4-(2-methoxyethoxy)anilino]acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[[2-[4-(2-methoxyethoxy)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54822273 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[[2-[4-(2-methoxyethoxy)anilino]acetyl]amino]benzamide |
| SMILES | COCCOc1ccc(NCC(=O)Nc2ccc(C(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-29-13-14-31-20-10-8-18(9-11-20)24-16-22(27)26-19-6-4-17(5-7-19)23(28)25-15-21-3-2-12-30-21/h2-12,24H,13-16H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | ULBFCCMAFISCNY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|