C24H27N3O4 — CID 54843077
N-(furan-2-ylmethyl)-4-[[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54843077) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54843077 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CC(C)COc1cccc(NC(=O)CNc2ccc(C(=O)NCc3ccco3)cc2)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-17(2)16-31-21-6-3-5-20(13-21)27-23(28)15-25-19-10-8-18(9-11-19)24(29)26-14-22-7-4-12-30-22/h3-13,17,25H,14-16H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | RZHGQHAFUMMETJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |