C26H31N3O4 — CID 54823454
N-(furan-2-ylmethyl)-4-[[2-(3-hexoxyanilino)acetyl]amino]benzamide (PubChem CID 54823454) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[[2-(3-hexoxyanilino)acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[[2-(3-hexoxyanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54823454 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[[2-(3-hexoxyanilino)acetyl]amino]benzamide |
| SMILES | CCCCCCOc1cccc(NCC(=O)Nc2ccc(C(=O)NCc3ccco3)cc2)c1 |
| InChI | InChI=1S/C26H31N3O4/c1-2-3-4-5-15-32-23-9-6-8-22(17-23)27-19-25(30)29-21-13-11-20(12-14-21)26(31)28-18-24-10-7-16-33-24/h6-14,16-17,27H,2-5,15,18-19H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | JLULPLKXWHYQHX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|