C24H26N4O4 — CID 54834695
N-(furan-2-ylmethyl)-3-[[2-oxo-2-[4-(propylcarbamoyl)anilino]ethyl]amino]benzamide (PubChem CID 54834695) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[2-oxo-2-[4-(propylcarbamoyl)anilino]ethyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[2-oxo-2-[4-(propylcarbamoyl)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834695 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[2-oxo-2-[4-(propylcarbamoyl)anilino]ethyl]amino]benzamide |
| SMILES | CCCNC(=O)c1ccc(NC(=O)CNc2cccc(C(=O)NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-2-12-25-23(30)17-8-10-19(11-9-17)28-22(29)16-26-20-6-3-5-18(14-20)24(31)27-15-21-7-4-13-32-21/h3-11,13-14,26H,2,12,15-16H2,1H3,(H,25,30)(H,27,31)(H,28,29) |
| InChIKey | TUEGFFGCUWYGKS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |