C25H28N4O4 — CID 54834424
3-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 54834424) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54834424 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CNc2cccc(C(=O)NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C25H28N4O4/c1-3-29(4-2)25(32)18-10-12-20(13-11-18)28-23(30)17-26-21-8-5-7-19(15-21)24(31)27-16-22-9-6-14-33-22/h5-15,26H,3-4,16-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | YYXDAYFUJQEIGL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |