C25H28N4O4 — CID 54842839
N-tert-butyl-3-[[2-[4-(furan-2-ylmethylcarbamoyl)anilino]acetyl]amino]benzamide (PubChem CID 54842839) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-tert-butyl-3-[[2-[4-(furan-2-ylmethylcarbamoyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-tert-butyl-3-[[2-[4-(furan-2-ylmethylcarbamoyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54842839 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-tert-butyl-3-[[2-[4-(furan-2-ylmethylcarbamoyl)anilino]acetyl]amino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=O)CNc2ccc(C(=O)NCc3ccco3)cc2)c1 |
| InChI | InChI=1S/C25H28N4O4/c1-25(2,3)29-24(32)18-6-4-7-20(14-18)28-22(30)16-26-19-11-9-17(10-12-19)23(31)27-15-21-8-5-13-33-21/h4-14,26H,15-16H2,1-3H3,(H,27,31)(H,28,30)(H,29,32) |
| InChIKey | PYCJVEUKNMACOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |