C24H27N3O4 — CID 54820132
4-[[2-(4-butoxyanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 54820132) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[[2-(4-butoxyanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-[[2-(4-butoxyanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54820132 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-[[2-(4-butoxyanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CCCCOc1ccc(NCC(=O)Nc2ccc(C(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-2-3-14-30-21-12-10-19(11-13-21)25-17-23(28)27-20-8-6-18(7-9-20)24(29)26-16-22-5-4-15-31-22/h4-13,15,25H,2-3,14,16-17H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | WXAOOPVBXNCITJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|