C27H33N3O4 — CID 54834514
N-(furan-2-ylmethyl)-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]benzamide (PubChem CID 54834514) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834514 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]benzamide |
| SMILES | CCCCCCCOc1cccc(NC(=O)CNc2cccc(C(=O)NCc3ccco3)c2)c1 |
| InChI | InChI=1S/C27H33N3O4/c1-2-3-4-5-6-15-33-24-13-8-12-23(18-24)30-26(31)20-28-22-11-7-10-21(17-22)27(32)29-19-25-14-9-16-34-25/h7-14,16-18,28H,2-6,15,19-20H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | UQIQMYDTUOTDTB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|