C20H28N2O3 — CID 54821868
N-(furan-2-ylmethyl)-2-(4-heptoxyanilino)acetamide (PubChem CID 54821868) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-heptoxyanilino)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(4-heptoxyanilino)acetamide |
|---|---|
| PubChem CID | 54821868 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-heptoxyanilino)acetamide |
| SMILES | CCCCCCCOc1ccc(NCC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-3-4-5-6-13-24-18-11-9-17(10-12-18)21-16-20(23)22-15-19-8-7-14-25-19/h7-12,14,21H,2-6,13,15-16H2,1H3,(H,22,23) |
| InChIKey | QHCZRWYDARCYMO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|