C16H19N3O3 — CID 54835371
N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]phenyl]propanamide (PubChem CID 54835371) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]phenyl]propanamide.
| Compound Name | N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54835371 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NCC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-2-15(20)19-13-7-5-12(6-8-13)17-11-16(21)18-10-14-4-3-9-22-14/h3-9,17H,2,10-11H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | WNSSCTOCOPGFJT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |