C29H29N3O4 — CID 54825672
N-(furan-2-ylmethyl)-3-[[2-[4-(3-phenylpropoxy)anilino]acetyl]amino]benzamide (PubChem CID 54825672) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[2-[4-(3-phenylpropoxy)anilino]acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[2-[4-(3-phenylpropoxy)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54825672 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[2-[4-(3-phenylpropoxy)anilino]acetyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(OCCCc2ccccc2)cc1)Nc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C29H29N3O4/c33-28(32-25-11-4-10-23(19-25)29(34)31-20-27-12-6-18-36-27)21-30-24-13-15-26(16-14-24)35-17-5-9-22-7-2-1-3-8-22/h1-4,6-8,10-16,18-19,30H,5,9,17,20-21H2,(H,31,34)(H,32,33) |
| InChIKey | PSSNADCACFSRCT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|