C16H25ClN4O2 — CID 119702311
(2S)-2-amino-3,3-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride (PubChem CID 119702311) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119702311 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)[C@@H](N)C(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C16H24N4O2.ClH/c1-5-10-18-15(22)20-12-8-6-11(7-9-12)19-14(21)13(17)16(2,3)4;/h5-9,13H,1,10,17H2,2-4H3,(H,19,21)(H2,18,20,22);1H/t13-;/m1./s1 |
| InChIKey | BNPUERWHAQZPNZ-BTQNPOSSSA-N |
| XLogP | 2.73 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|