C15H19N3O2 — CID 47146193
2-methyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide (PubChem CID 47146193) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-methyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-methyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 47146193 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-methyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)C2CC2C)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-3-8-16-15(20)18-12-6-4-11(5-7-12)17-14(19)13-9-10(13)2/h3-7,10,13H,1,8-9H2,2H3,(H,17,19)(H2,16,18,20) |
| InChIKey | IFWLUHHOCJWPBC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|