C16H21N3O2 — CID 122159832
(1S)-2,2-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide (PubChem CID 122159832) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 122159832 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (1S)-2,2-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]cyclopropane-1-carboxamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)[C@H]2CC2(C)C)cc1 |
| InChI | InChI=1S/C16H21N3O2/c1-4-9-17-15(21)19-12-7-5-11(6-8-12)18-14(20)13-10-16(13,2)3/h4-8,13H,1,9-10H2,2-3H3,(H,18,20)(H2,17,19,21)/t13-/m1/s1 |
| InChIKey | NEBIPSXXHSIWHA-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|