C12H12N2O5 — CID 61193523
5-(prop-2-enylcarbamoylamino)benzene-1,3-dicarboxylic acid (PubChem CID 61193523) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 5-(prop-2-enylcarbamoylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(prop-2-enylcarbamoylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 61193523 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-(prop-2-enylcarbamoylamino)benzene-1,3-dicarboxylic acid |
| SMILES | C=CCNC(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H12N2O5/c1-2-3-13-12(19)14-9-5-7(10(15)16)4-8(6-9)11(17)18/h2,4-6H,1,3H2,(H,15,16)(H,17,18)(H2,13,14,19) |
| InChIKey | GBLMTORUOIAOHQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|