C9H9Cl2N3O — CID 3866775
1-(2,6-dichloro-4-pyridinyl)-3-prop-2-enylurea (PubChem CID 3866775) has the molecular formula C9H9Cl2N3O and a molecular weight of 246.10 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-prop-2-enylurea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 3866775 |
| Molecular Formula | C9H9Cl2N3O |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2N3O/c1-2-3-12-9(15)13-6-4-7(10)14-8(11)5-6/h2,4-5H,1,3H2,(H2,12,13,14,15) |
| InChIKey | RFKQXYDZCJUONJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|