C18H16Cl2N4O2 — CID 6265792
N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-(prop-2-enylcarbamoylamino)benzamide (PubChem CID 6265792) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-(prop-2-enylcarbamoylamino)benzamide.
| Compound Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-(prop-2-enylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 6265792 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-(prop-2-enylcarbamoylamino)benzamide |
| SMILES | C=CCNC(=O)Nc1ccc(C(=O)N/N=C\c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H16Cl2N4O2/c1-2-9-21-18(26)23-14-6-4-13(5-7-14)17(25)24-22-11-12-3-8-15(19)16(20)10-12/h2-8,10-11H,1,9H2,(H,24,25)(H2,21,23,26)/b22-11- |
| InChIKey | DECMLVFNXASXQW-JJFYIABZSA-N |
| XLogP | 4.06 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|