C13H12BrCl2N3O — CID 143498251
1-[(6-bromocyclohexa-2,4-dien-1-yl)methyl]-3-(2,6-dichloro-4-pyridinyl)urea (PubChem CID 143498251) has the molecular formula C13H12BrCl2N3O and a molecular weight of 377.07 g/mol. Its IUPAC name is 1-[(6-bromocyclohexa-2,4-dien-1-yl)methyl]-3-(2,6-dichloro-4-pyridinyl)urea.
| Compound Name | 1-[(6-bromocyclohexa-2,4-dien-1-yl)methyl]-3-(2,6-dichloro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 143498251 |
| Molecular Formula | C13H12BrCl2N3O |
| Molecular Weight | 377.07 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 1-[(6-bromocyclohexa-2,4-dien-1-yl)methyl]-3-(2,6-dichloro-4-pyridinyl)urea |
| SMILES | O=C(NCC1C=CC=CC1Br)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H12BrCl2N3O/c14-10-4-2-1-3-8(10)7-17-13(20)18-9-5-11(15)19-12(16)6-9/h1-6,8,10H,7H2,(H2,17,18,19,20) |
| InChIKey | FHBSTIBCHAHNHR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.07 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|