C13H9Cl2F2N3O2 — CID 156854528
1-(2,6-dichloro-4-pyridinyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea (PubChem CID 156854528) has the molecular formula C13H9Cl2F2N3O2 and a molecular weight of 348.14 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 156854528 |
| Molecular Formula | C13H9Cl2F2N3O2 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea |
| SMILES | O=C(Nc1cc(Cl)nc(Cl)c1)Nc1cc(F)cc(F)c1CO |
| InChI | InChI=1S/C13H9Cl2F2N3O2/c14-11-3-7(4-12(15)20-11)18-13(22)19-10-2-6(16)1-9(17)8(10)5-21/h1-4,21H,5H2,(H2,18,19,20,22) |
| InChIKey | YADCVWRSKWXCIF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|