C14H10Cl2F2N2O2 — CID 166747549
1-(3,5-dichlorophenyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea (PubChem CID 166747549) has the molecular formula C14H10Cl2F2N2O2 and a molecular weight of 347.15 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 166747549 |
| Molecular Formula | C14H10Cl2F2N2O2 |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[3,5-difluoro-2-(hydroxymethyl)phenyl]urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1cc(F)cc(F)c1CO |
| InChI | InChI=1S/C14H10Cl2F2N2O2/c15-7-1-8(16)3-10(2-7)19-14(22)20-13-5-9(17)4-12(18)11(13)6-21/h1-5,21H,6H2,(H2,19,20,22) |
| InChIKey | RQFJXSQNXVLUSW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |