C13H8F4N2O — CID 46859669
1-(2,4-difluorophenyl)-3-(3,5-difluorophenyl)urea (PubChem CID 46859669) has the molecular formula C13H8F4N2O and a molecular weight of 284.21 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3,5-difluorophenyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 46859669 |
| Molecular Formula | C13H8F4N2O |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3,5-difluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)cc(F)c1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H8F4N2O/c14-7-1-2-12(11(17)6-7)19-13(20)18-10-4-8(15)3-9(16)5-10/h1-6H,(H2,18,19,20) |
| InChIKey | MHBFAZYDILVAKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |